Name | (3e)-5-(2-methylprop-1-en-1-yl)-3-(4-oxopentylidene)oxolan-2-one |
Wikidata | Q105024869 |
Mol. formula | C13H18O3 |
CAS registry number | - |
Mol. weight | 222.2807 |
Temporary LOTUS id | LTS0017132 |
Name | (3e)-5-(2-methylprop-1-en-1-yl)-3-(4-oxopentylidene)oxolan-2-one |
Canonical SMILES | CC(=O)CC/C=C1\CC(C=C(C)C)OC1=O |
2D SMILES | CC(=O)CCC=C1CC(C=C(C)C)OC1=O |
IUPAC name | (3E)-5-(2-methylprop-1-en-1-yl)-3-(4-oxopentylidene)oxolan-2-one |
InChI | InChI=1S/C13H18O3/c1-9(2)7-12-8-11(13(15)16-12)6-4-5-10(3)14/h6-7,12H,4-5,8H2,1-3H3/b11-6+ |
InChIKey | HAGKOYTUAINBNR-IZZDOVSWSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCCC1 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Phytane diterpenoids |
Total atom number | 34 |
Heavy atom number | 16 |
Bond count | 16 |
Number of carbons | 13 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1 |
Alogp | 2.25 |
Alogp2 | 5.04 |
Apol | 37.2883 |
Bpol | 23.5097 |
EccentricConnectivityIndexDescriptor | 239 |
FmfDescriptor | 0.3125 |
Fsp3 | 0.5385 |
FragmentComplexityDescriptor | 916.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 507 |
Xlogp | 1.586 |
ZagrebIndex | 74 |
TopoPSA | 43.37 |