Name | 4-hydroxy-6-(2-hydroxypropan-2-yl)-5-methyl-1-(3-methylbut-2-en-1-yl)-3-(2-methylbutanoyl)bicyclo[3.2.1]oct-3-ene-2,8-dione |
Wikidata | Q104667973 |
Mol. formula | C22H32O5 |
CAS registry number | - |
Mol. weight | 376.4873 |
Temporary LOTUS id | LTS0016486 |
Name | 4-hydroxy-6-(2-hydroxypropan-2-yl)-5-methyl-1-(3-methylbut-2-en-1-yl)-3-(2-methylbutanoyl)bicyclo[3.2.1]oct-3-ene-2,8-dione |
Canonical SMILES | CCC(C)C(=O)C1=C(O)C2(C)C(=O)C(CC=C(C)C)(CC2C(C)(C)O)C1=O |
2D SMILES | CCC(C)C(=O)C1=C(O)C2(C)C(=O)C(CC=C(C)C)(CC2C(C)(C)O)C1=O |
IUPAC name | 4-hydroxy-6-(2-hydroxypropan-2-yl)-5-methyl-1-(3-methylbut-2-en-1-yl)-3-(2-methylbutanoyl)bicyclo[3.2.1]oct-3-ene-2,8-dione |
InChI | InChI=1S/C22H32O5/c1-8-13(4)16(23)15-17(24)21(7)14(20(5,6)27)11-22(18(15)25,19(21)26)10-9-12(2)3/h9,13-14,24,27H,8,10-11H2,1-7H3 |
InChIKey | LUXKGFHAIQDUBG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC2CCC(C1)C2 |
Pathway | Superclass | Class |
Polyketides | Meroterpenoids | Polyprenylated cyclic polyketides (Hop meroterpenoids) |
Total atom number | 59 |
Heavy atom number | 27 |
Bond count | 28 |
Number of carbons | 22 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.67 |
Alogp | 3.02 |
Alogp2 | 9.1 |
Apol | 64.0674 |
Bpol | 37.8566 |
EccentricConnectivityIndexDescriptor | 413 |
FmfDescriptor | 0.2963 |
Fsp3 | 0.6818 |
FragmentComplexityDescriptor | 2898.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1551 |
Xlogp | 3.367 |
ZagrebIndex | 148 |
TopoPSA | 91.67 |