Name | 5-(4-methoxyphenyl)-2-phenyl-1,3-oxazole |
Wikidata | Q82225211 |
Mol. formula | C16H13NO2 |
CAS registry number | - |
Mol. weight | 251.2805 |
Temporary LOTUS id | LTS0016404 |
Name | 5-(4-methoxyphenyl)-2-phenyl-1,3-oxazole |
Canonical SMILES | COc1ccc(-c2cnc(-c3ccccc3)o2)cc1 |
2D SMILES | COc1ccc(-c2cnc(-c3ccccc3)o2)cc1 |
IUPAC name | 5-(4-methoxyphenyl)-2-phenyl-1,3-oxazole |
InChI | InChI=1S/C16H13NO2/c1-18-14-9-7-12(8-10-14)15-11-17-16(19-15)13-5-3-2-4-6-13/h2-11H,1H3 |
InChIKey | ONQKZEWRQOTVRA-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | n1cc(oc1-c2ccccc2)-c3ccccc3 |
Pathway | Superclass | Class |
Alkaloids | Tyrosine alkaloids | Oxazole alkaloids |
Total atom number | 32 |
Heavy atom number | 19 |
Bond count | 21 |
Number of carbons | 16 |
Minimal number of rings | 3 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 3.45 |
Alogp2 | 11.87 |
Apol | 39.5323 |
Bpol | 19.3637 |
EccentricConnectivityIndexDescriptor | 374 |
FmfDescriptor | 0.8947 |
Fsp3 | 0.0625 |
FragmentComplexityDescriptor | 814.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 767 |
Xlogp | 3.673 |
ZagrebIndex | 98 |
TopoPSA | 35.26 |