Name | 3a-methyl-6-methylidene-1-(prop-1-en-2-yl)-octahydroazulen-5-ol |
Wikidata | Q105143403 |
Mol. formula | C15H24O |
CAS registry number | - |
Mol. weight | 220.351 |
Temporary LOTUS id | LTS0015958 |
Name | 3a-methyl-6-methylidene-1-(prop-1-en-2-yl)-octahydroazulen-5-ol |
Canonical SMILES | C=C1CCC2C(C(=C)C)CCC2(C)CC1O |
2D SMILES | C=C1CCC2C(C(=C)C)CCC2(C)CC1O |
IUPAC name | 3a-methyl-6-methylidene-1-(prop-1-en-2-yl)-decahydroazulen-5-ol |
InChI | InChI=1S/C15H24O/c1-10(2)12-7-8-15(4)9-14(16)11(3)5-6-13(12)15/h12-14,16H,1,3,5-9H2,2,4H3 |
InChIKey | KNGFBLYDZOXQMM-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCC2CCCC2CC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Daucane sesquiterpenoids |
Total atom number | 40 |
Heavy atom number | 16 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 3.71 |
Alogp2 | 13.73 |
Apol | 43.205 |
Bpol | 26.237 |
EccentricConnectivityIndexDescriptor | 180 |
FmfDescriptor | 0.625 |
Fsp3 | 0.7333 |
FragmentComplexityDescriptor | 1441.01 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 388 |
Xlogp | 4.164 |
ZagrebIndex | 86 |
TopoPSA | 20.23 |