Temporary LOTUS id | LTS0014343 |
Name | Optimax |
Canonical SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)O |
2D SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)O |
IUPAC name | 2-amino-3-(1H-indol-3-yl)propanoic acid |
InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) |
InChIKey | QIVBCDIJIAJPQS-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2[nH]ccc2c1 |
Pathway | Superclass | Class |
Amino acids and Peptides | Small peptides | Aminoacids |
Total atom number | 27 |
Heavy atom number | 15 |
Bond count | 16 |
Number of carbons | 11 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.4 |
Alogp | 1.25 |
Alogp2 | 1.56 |
Apol | 31.1655 |
Bpol | 14.0765 |
EccentricConnectivityIndexDescriptor | 195 |
FmfDescriptor | 0.6 |
Fsp3 | 0.1818 |
FragmentComplexityDescriptor | 574.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 369 |
Xlogp | -1.271 |
ZagrebIndex | 76 |
TopoPSA | 79.11 |