Name | 1-ethyl-4-methoxy-9h-pyrido[3,4-b]indole |
Wikidata | Q72461691 |
Mol. formula | C14H14N2O |
CAS registry number | - |
Mol. weight | 226.2743 |
Temporary LOTUS id | LTS0014313 |
Name | 1-ethyl-4-methoxy-9h-pyrido[3,4-b]indole |
Canonical SMILES | CCc1ncc(OC)c2c1[nH]c1ccccc12 |
2D SMILES | CCc1ncc(OC)c2c1[nH]c1ccccc12 |
IUPAC name | 1-ethyl-4-methoxy-9H-pyrido[3,4-b]indole |
InChI | InChI=1S/C14H14N2O/c1-3-10-14-13(12(17-2)8-15-10)9-6-4-5-7-11(9)16-14/h4-8,16H,3H2,1-2H3 |
InChIKey | LWWRUTVIAQDHRE-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | n1ccc2c(c1)[nH]c3ccccc32 |
Pathway | Superclass | Class |
Alkaloids | Tryptophan alkaloids | Carboline alkaloids |
Total atom number | 31 |
Heavy atom number | 17 |
Bond count | 19 |
Number of carbons | 14 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 3.11 |
Alogp2 | 9.65 |
Apol | 36.9771 |
Bpol | 19.2009 |
EccentricConnectivityIndexDescriptor | 208 |
FmfDescriptor | 0.7647 |
Fsp3 | 0.2143 |
FragmentComplexityDescriptor | 817.03 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 459 |
Xlogp | 2.762 |
ZagrebIndex | 92 |
TopoPSA | 37.91 |