Name | (3r,3as,4s,7ar,8s,9ar)-4-hydroxy-3,5,8-trimethyl-3h,3ah,4h,7h,7ah,8h,9h,9ah-azuleno[6,5-b]furan-2,6-dione |
Wikidata | Q104934975 |
Mol. formula | C15H20O4 |
CAS registry number | - |
Mol. weight | 264.3175 |
Temporary LOTUS id | LTS0013211 |
Name | (3r,3as,4s,7ar,8s,9ar)-4-hydroxy-3,5,8-trimethyl-3h,3ah,4h,7h,7ah,8h,9h,9ah-azuleno[6,5-b]furan-2,6-dione |
Canonical SMILES | CC1=C2[C@@H](O)[C@H]3[C@@H](C[C@H](C)[C@H]2CC1=O)OC(=O)[C@@H]3C |
2D SMILES | CC1=C2C(O)C3C(CC(C)C2CC1=O)OC(=O)C3C |
IUPAC name | (3R,3aS,4S,7aR,8S,9aR)-4-hydroxy-3,5,8-trimethyl-2H,3H,3aH,4H,6H,7H,7aH,8H,9H,9aH-azuleno[6,5-b]furan-2,6-dione |
InChI | InChI=1S/C15H20O4/c1-6-4-11-13(8(3)15(18)19-11)14(17)12-7(2)10(16)5-9(6)12/h6,8-9,11,13-14,17H,4-5H2,1-3H3/t6-,8+,9+,11+,13+,14+/m0/s1 |
InChIKey | BFWXQSLJSDLIAA-IHVHESTJSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CC3=CCCC3CCC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Guaiane sesquiterpenoids |
Total atom number | 39 |
Heavy atom number | 19 |
Bond count | 21 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.03 |
Alogp | 1.3 |
Alogp2 | 1.69 |
Apol | 42.9439 |
Bpol | 25.6961 |
EccentricConnectivityIndexDescriptor | 250 |
FmfDescriptor | 0.6842 |
Fsp3 | 0.7333 |
FragmentComplexityDescriptor | 1339.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 591 |
Xlogp | 0.432 |
ZagrebIndex | 108 |
TopoPSA | 63.6 |