Name | 2-[3-hydroxy-5-methoxy-4-(3-methylbut-2-en-1-yl)phenyl]-1-benzofuran-6-ol |
Wikidata | Q105149708 |
Mol. formula | C20H20O4 |
CAS registry number | - |
Mol. weight | 324.3712 |
Temporary LOTUS id | LTS0011667 |
Name | 2-[3-hydroxy-5-methoxy-4-(3-methylbut-2-en-1-yl)phenyl]-1-benzofuran-6-ol |
Canonical SMILES | COc1cc(-c2cc3ccc(O)cc3o2)cc(O)c1CC=C(C)C |
2D SMILES | COc1cc(-c2cc3ccc(O)cc3o2)cc(O)c1CC=C(C)C |
IUPAC name | 2-[3-hydroxy-5-methoxy-4-(3-methylbut-2-en-1-yl)phenyl]-1-benzofuran-6-ol |
InChI | InChI=1S/C20H20O4/c1-12(2)4-7-16-17(22)8-14(10-20(16)23-3)18-9-13-5-6-15(21)11-19(13)24-18/h4-6,8-11,21-22H,7H2,1-3H3 |
InChIKey | LBZMBHMMTWMONT-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | o1c2ccccc2cc1-c3ccccc3 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Isoflavonoids | 2-arylbenzofurans |
Total atom number | 44 |
Heavy atom number | 24 |
Bond count | 26 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1 |
Alogp | 5.25 |
Alogp2 | 27.55 |
Apol | 51.7439 |
Bpol | 25.6961 |
EccentricConnectivityIndexDescriptor | 502 |
FmfDescriptor | 0.625 |
Fsp3 | 0.2 |
FragmentComplexityDescriptor | 1564.04 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1390 |
Xlogp | 4.789 |
ZagrebIndex | 126 |
TopoPSA | 62.83 |