Name | 13-hydroxy-3,7,12-trimethyl-13-(prop-1-en-2-yl)-10,14,16-trioxatetracyclo[7.5.1.1³,⁶.0¹²,¹⁵]hexadeca-5,7-diene-4,11-dione |
Wikidata | Q105347249 |
Mol. formula | C19H22O6 |
CAS registry number | - |
Mol. weight | 346.3751 |
Temporary LOTUS id | LTS0011362 |
Name | 13-hydroxy-3,7,12-trimethyl-13-(prop-1-en-2-yl)-10,14,16-trioxatetracyclo[7.5.1.1³,⁶.0¹²,¹⁵]hexadeca-5,7-diene-4,11-dione |
Canonical SMILES | C=C(C)C1(O)OC2CC3(C)OC(=CC3=O)C(C)=CC3OC(=O)C1(C)C32 |
2D SMILES | C=C(C)C1(O)OC2CC3(C)OC(=CC3=O)C(C)=CC3OC(=O)C1(C)C32 |
IUPAC name | 13-hydroxy-3,7,12-trimethyl-13-(prop-1-en-2-yl)-10,14,16-trioxatetracyclo[7.5.1.1³,⁶.0¹²,¹⁵]hexadeca-5,7-diene-4,11-dione |
InChI | InChI=1S/C19H22O6/c1-9(2)19(22)18(5)15-12(23-16(18)21)6-10(3)11-7-14(20)17(4,24-11)8-13(15)25-19/h6-7,12-13,15,22H,1,8H2,2-5H3 |
InChIKey | YEIAHHGCPUIGOQ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C=2C=CC3OCC4COC(CC1CC2)C34 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 47 |
Heavy atom number | 25 |
Bond count | 28 |
Number of carbons | 19 |
Minimal number of rings | 4 |
Maximal number of rings | 12 |
NP-likeness score | 1.19 |
Alogp | 1.24 |
Alogp2 | 1.55 |
Apol | 52.9214 |
Bpol | 31.7146 |
EccentricConnectivityIndexDescriptor | 367 |
FmfDescriptor | 0.64 |
Fsp3 | 0.5789 |
FragmentComplexityDescriptor | 1900.06 |
PetitjeanNumber | 0.375 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1184 |
Xlogp | 0.353 |
ZagrebIndex | 152 |
TopoPSA | 82.06 |