Name | [(1s,7r)-7-hydroxy-hexahydro-1h-pyrrolizin-1-yl]methyl (2e)-2-methylbut-2-enoate |
Wikidata | Q104375217 |
Mol. formula | C13H21NO3 |
CAS registry number | - |
Mol. weight | 239.3112 |
Temporary LOTUS id | LTS0011308 |
Name | [(1s,7r)-7-hydroxy-hexahydro-1h-pyrrolizin-1-yl]methyl (2e)-2-methylbut-2-enoate |
Canonical SMILES | C/C=C(\C)C(=O)OC[C@H]1CCN2CC[C@@H](O)C12 |
2D SMILES | CC=C(C)C(=O)OCC1CCN2CCC(O)C12 |
IUPAC name | [(1S,7R)-7-hydroxy-hexahydro-1H-pyrrolizin-1-yl]methyl (2E)-2-methylbut-2-enoate |
InChI | InChI=1S/C13H21NO3/c1-3-9(2)13(16)17-8-10-4-6-14-7-5-11(15)12(10)14/h3,10-12,15H,4-8H2,1-2H3/b9-3+/t10-,11-,12?/m1/s1 |
InChIKey | FOWFFDPFIJUTGG-JUUAVEPRSA-N |
Deep SMILES | could not be computed |
Murcko Framework | N12CCCC1CCC2 |
Pathway | Superclass | Class |
Alkaloids | Ornithine alkaloids | Pyrrolizidine alkaloids |
Total atom number | 38 |
Heavy atom number | 17 |
Bond count | 18 |
Number of carbons | 13 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 0.98 |
Alogp | 1.2 |
Alogp2 | 1.45 |
Apol | 40.3887 |
Bpol | 27.8113 |
EccentricConnectivityIndexDescriptor | 261 |
FmfDescriptor | 0.4706 |
Fsp3 | 0.7692 |
FragmentComplexityDescriptor | 1249.04 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 551 |
Xlogp | 0.984 |
ZagrebIndex | 86 |
TopoPSA | 49.77 |