Name | (2s,3r,6s)-6-[(1e,3e,5e)-deca-1,3,5-trien-1-yl]-1,2-dimethylpiperidin-3-yl acetate |
Wikidata | Q105131598 |
Mol. formula | C19H31NO2 |
CAS registry number | - |
Mol. weight | 305.4557 |
Temporary LOTUS id | LTS0008686 |
Name | (2s,3r,6s)-6-[(1e,3e,5e)-deca-1,3,5-trien-1-yl]-1,2-dimethylpiperidin-3-yl acetate |
Canonical SMILES | CCCC/C=C/C=C/C=C/[C@@H]1CC[C@@H](OC(C)=O)[C@H](C)N1C |
2D SMILES | CCCCC=CC=CC=CC1CCC(OC(C)=O)C(C)N1C |
IUPAC name | (2S,3R,6S)-6-[(1E,3E,5E)-deca-1,3,5-trien-1-yl]-1,2-dimethylpiperidin-3-yl acetate |
InChI | InChI=1S/C19H31NO2/c1-5-6-7-8-9-10-11-12-13-18-14-15-19(22-17(3)21)16(2)20(18)4/h8-13,16,18-19H,5-7,14-15H2,1-4H3/b9-8+,11-10+,13-12+/t16-,18+,19+/m0/s1 |
InChIKey | JMQLJAPSKRBPMT-YFKNEZHJSA-N |
Deep SMILES | could not be computed |
Murcko Framework | N1CCCCC1 |
Pathway | Superclass | Class |
Alkaloids | Lysine alkaloids | Piperidine alkaloids |
Total atom number | 53 |
Heavy atom number | 22 |
Bond count | 22 |
Number of carbons | 19 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.01 |
Alogp | 4.38 |
Alogp2 | 19.18 |
Apol | 56.8146 |
Bpol | 38.7434 |
EccentricConnectivityIndexDescriptor | 532 |
FmfDescriptor | 0.2727 |
Fsp3 | 0.6316 |
FragmentComplexityDescriptor | 2347.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1372 |
Xlogp | 5.329 |
ZagrebIndex | 98 |
TopoPSA | 29.54 |