Name | Bisacurone |
Wikidata | Q105222792 |
Mol. formula | C15H24O3 |
CAS registry number | - |
Mol. weight | 252.3498 |
Temporary LOTUS id | LTS0007825 |
Name | Bisacurone |
Canonical SMILES | CC(C)=CC(=O)C[C@H](C)[C@@H]1C=C[C@](C)(O)[C@@H](O)C1 |
2D SMILES | CC(C)=CC(=O)CC(C)C1C=CC(C)(O)C(O)C1 |
IUPAC name | (6S)-6-[(1R,4S,5S)-4,5-dihydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-en-4-one |
InChI | InChI=1S/C15H24O3/c1-10(2)7-13(16)8-11(3)12-5-6-15(4,18)14(17)9-12/h5-7,11-12,14,17-18H,8-9H2,1-4H3/t11-,12+,14-,15-/m0/s1 |
InChIKey | QJOWFYQIUZMPRY-NEBZKDRISA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Bisabolane sesquiterpenoids |
Total atom number | 42 |
Heavy atom number | 18 |
Bond count | 18 |
Number of carbons | 15 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.39 |
Alogp | 2.07 |
Alogp2 | 4.3 |
Apol | 44.809 |
Bpol | 27.195 |
EccentricConnectivityIndexDescriptor | 276 |
FmfDescriptor | 0.3333 |
Fsp3 | 0.6667 |
FragmentComplexityDescriptor | 1458.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 659 |
Xlogp | 1.793 |
ZagrebIndex | 88 |
TopoPSA | 57.53 |