Name | 1a-isopropyl-3a-methyl-2h,3h,4h,7h,8h-azuleno[3,3a-b]oxirene-6-carbaldehyde |
Wikidata | Q104909742 |
Mol. formula | C15H22O2 |
CAS registry number | - |
Mol. weight | 234.3345 |
Temporary LOTUS id | LTS0006047 |
Name | 1a-isopropyl-3a-methyl-2h,3h,4h,7h,8h-azuleno[3,3a-b]oxirene-6-carbaldehyde |
Canonical SMILES | CC(C)C12CCC3(C)CC=C(C=O)CCC31O2 |
2D SMILES | CC(C)C12CCC3(C)CC=C(C=O)CCC31O2 |
IUPAC name | 3a-methyl-1a-(propan-2-yl)-1aH,2H,3H,3aH,4H,7H,8H-azuleno[3,3a-b]oxirene-6-carbaldehyde |
InChI | InChI=1S/C15H22O2/c1-11(2)14-9-8-13(3)6-4-12(10-16)5-7-15(13,14)17-14/h4,10-11H,5-9H2,1-3H3 |
InChIKey | ADQAOLOAIMXAQN-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C2CCC3CC=CCCC123 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Daucane sesquiterpenoids |
Total atom number | 39 |
Heavy atom number | 17 |
Bond count | 19 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.27 |
Alogp | 2.92 |
Alogp2 | 8.54 |
Apol | 42.6734 |
Bpol | 26.9246 |
EccentricConnectivityIndexDescriptor | 225 |
FmfDescriptor | 0.6471 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 1409.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 450 |
Xlogp | 2.468 |
ZagrebIndex | 102 |
TopoPSA | 29.6 |