Name | (1s,4r)-3-formyl-2-(hydroxymethyl)-4-(3-oxoprop-1-en-2-yl)cyclopent-2-en-1-yl (2e)-3-(4-hydroxyphenyl)prop-2-enoate |
Wikidata | Q105116727 |
Mol. formula | C19H18O6 |
CAS registry number | - |
Mol. weight | 342.3433 |
Temporary LOTUS id | LTS0004480 |
Name | (1s,4r)-3-formyl-2-(hydroxymethyl)-4-(3-oxoprop-1-en-2-yl)cyclopent-2-en-1-yl (2e)-3-(4-hydroxyphenyl)prop-2-enoate |
Canonical SMILES | C=C(C=O)[C@H]1C[C@H](OC(=O)/C=C/c2ccc(O)cc2)C(CO)=C1C=O |
2D SMILES | C=C(C=O)C1CC(OC(=O)C=Cc2ccc(O)cc2)C(CO)=C1C=O |
IUPAC name | (1S,4R)-3-formyl-2-(hydroxymethyl)-4-(3-oxoprop-1-en-2-yl)cyclopent-2-en-1-yl (2E)-3-(4-hydroxyphenyl)prop-2-enoate |
InChI | InChI=1S/C19H18O6/c1-12(9-20)15-8-18(17(11-22)16(15)10-21)25-19(24)7-4-13-2-5-14(23)6-3-13/h2-7,9-10,15,18,22-23H,1,8,11H2/b7-4+/t15-,18+/m1/s1 |
InChIKey | IOKUHHOVWITKLG-TUVQABDQSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O(CC=Cc1ccccc1)C2C=CCC2 |
Pathway | Superclass | Class |
Terpenoids | Monoterpenoids | Iridoids monoterpenoids |
Total atom number | 43 |
Heavy atom number | 25 |
Bond count | 26 |
Number of carbons | 19 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.01 |
Alogp | 1.88 |
Alogp2 | 3.52 |
Apol | 50.2543 |
Bpol | 24.4677 |
EccentricConnectivityIndexDescriptor | 557 |
FmfDescriptor | 0.6 |
Fsp3 | 0.2105 |
FragmentComplexityDescriptor | 1336.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1665 |
Xlogp | 0.684 |
ZagrebIndex | 122 |
TopoPSA | 100.9 |