Name | 16-hydroxy-5-(hydroxymethyl)-5,9,13-trimethylpentacyclo[11.2.1.0¹,¹⁰.0⁴,⁹.0¹²,¹⁴]hexadecan-2-one |
Wikidata | Q105259893 |
Mol. formula | C20H30O3 |
CAS registry number | - |
Mol. weight | 318.4512 |
Temporary LOTUS id | LTS0000510 |
Name | 16-hydroxy-5-(hydroxymethyl)-5,9,13-trimethylpentacyclo[11.2.1.0¹,¹⁰.0⁴,⁹.0¹²,¹⁴]hexadecan-2-one |
Canonical SMILES | CC1(CO)CCCC2(C)C1CC(=O)C13CC4C(CC21)C4(C)C3O |
2D SMILES | CC1(CO)CCCC2(C)C1CC(=O)C13CC4C(CC21)C4(C)C3O |
IUPAC name | 16-hydroxy-5-(hydroxymethyl)-5,9,13-trimethylpentacyclo[11.2.1.0¹,¹⁰.0⁴,⁹.0¹²,¹⁴]hexadecan-2-one |
InChI | InChI=1S/C20H30O3/c1-17(10-21)5-4-6-18(2)13(17)8-15(22)20-9-12-11(7-14(18)20)19(12,3)16(20)23/h11-14,16,21,23H,4-10H2,1-3H3 |
InChIKey | SSTASBUCOHAYRJ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCC2C(C1)CCC34CC5C(CC23)C5C4 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Trachylobane diterpenoids |
Total atom number | 53 |
Heavy atom number | 23 |
Bond count | 27 |
Number of carbons | 20 |
Minimal number of rings | 5 |
Maximal number of rings | 18 |
NP-likeness score | 1.02 |
Alogp | 1.8 |
Alogp2 | 3.25 |
Apol | 57.6098 |
Bpol | 33.7542 |
EccentricConnectivityIndexDescriptor | 358 |
FmfDescriptor | 0.6957 |
Fsp3 | 0.95 |
FragmentComplexityDescriptor | 2743.03 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 936 |
Xlogp | 2.716 |
ZagrebIndex | 152 |
TopoPSA | 57.53 |